C14H16N6O3S — CID 18160681
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4,5-dimethyl-2-nitrophenyl)acetamide (PubChem CID 18160681) has the molecular formula C14H16N6O3S and a molecular weight of 348.39 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4,5-dimethyl-2-nitrophenyl)acetamide.
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4,5-dimethyl-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 18160681 |
| Molecular Formula | C14H16N6O3S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(4,5-dimethyl-2-nitrophenyl)acetamide |
| SMILES | Cc1cc(NC(=O)CSc2nc(N)cc(N)n2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C14H16N6O3S/c1-7-3-9(10(20(22)23)4-8(7)2)17-13(21)6-24-14-18-11(15)5-12(16)19-14/h3-5H,6H2,1-2H3,(H,17,21)(H4,15,16,18,19) |
| InChIKey | TWIKKXYSSBBZBV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 150.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|