C16H22N2O3S — CID 8705844
2-cyclohexylsulfanyl-N-(4,5-dimethyl-2-nitrophenyl)acetamide (PubChem CID 8705844) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-N-(4,5-dimethyl-2-nitrophenyl)acetamide.
| Compound Name | 2-cyclohexylsulfanyl-N-(4,5-dimethyl-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 8705844 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-cyclohexylsulfanyl-N-(4,5-dimethyl-2-nitrophenyl)acetamide |
| SMILES | Cc1cc(NC(=O)CSC2CCCCC2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C16H22N2O3S/c1-11-8-14(15(18(20)21)9-12(11)2)17-16(19)10-22-13-6-4-3-5-7-13/h8-9,13H,3-7,10H2,1-2H3,(H,17,19) |
| InChIKey | OXMSHDULCZXYEY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|