C13H14Cl3NOS — CID 7825724
2-cyclopentylsulfanyl-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 7825724) has the molecular formula C13H14Cl3NOS and a molecular weight of 338.69 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-cyclopentylsulfanyl-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 7825724 |
| Molecular Formula | C13H14Cl3NOS |
| Molecular Weight | 338.69 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 2-cyclopentylsulfanyl-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(CSC1CCCC1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl3NOS/c14-9-5-11(16)12(6-10(9)15)17-13(18)7-19-8-3-1-2-4-8/h5-6,8H,1-4,7H2,(H,17,18) |
| InChIKey | HVQRSTVAJZHXCA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.69 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|