C18H21Cl3N4OS — CID 17303311
2-[(5-cyclohexyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 17303311) has the molecular formula C18H21Cl3N4OS and a molecular weight of 447.82 g/mol. Its IUPAC name is 2-[(5-cyclohexyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[(5-cyclohexyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 17303311 |
| Molecular Formula | C18H21Cl3N4OS |
| Molecular Weight | 447.82 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 2-[(5-cyclohexyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CCn1c(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)nnc1C1CCCCC1 |
| InChI | InChI=1S/C18H21Cl3N4OS/c1-2-25-17(11-6-4-3-5-7-11)23-24-18(25)27-10-16(26)22-15-9-13(20)12(19)8-14(15)21/h8-9,11H,2-7,10H2,1H3,(H,22,26) |
| InChIKey | PUKZHXJKSOQKOO-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.82 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|