C14H15Cl3N4OS — CID 19716003
2-[(5-methyl-4-propyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 19716003) has the molecular formula C14H15Cl3N4OS and a molecular weight of 393.73 g/mol. Its IUPAC name is 2-[(5-methyl-4-propyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[(5-methyl-4-propyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 19716003 |
| Molecular Formula | C14H15Cl3N4OS |
| Molecular Weight | 393.73 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 2-[(5-methyl-4-propyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CCCn1c(C)nnc1SCC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl3N4OS/c1-3-4-21-8(2)19-20-14(21)23-7-13(22)18-12-6-10(16)9(15)5-11(12)17/h5-6H,3-4,7H2,1-2H3,(H,18,22) |
| InChIKey | QDZREUCRECRNCN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.73 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|