C21H21Cl3N4O2S — CID 17304686
2-[[5-[(3,5-dimethylphenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 17304686) has the molecular formula C21H21Cl3N4O2S and a molecular weight of 499.85 g/mol. Its IUPAC name is 2-[[5-[(3,5-dimethylphenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[5-[(3,5-dimethylphenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 17304686 |
| Molecular Formula | C21H21Cl3N4O2S |
| Molecular Weight | 499.85 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | 2-[[5-[(3,5-dimethylphenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CCn1c(COc2cc(C)cc(C)c2)nnc1SCC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C21H21Cl3N4O2S/c1-4-28-19(10-30-14-6-12(2)5-13(3)7-14)26-27-21(28)31-11-20(29)25-18-9-16(23)15(22)8-17(18)24/h5-9H,4,10-11H2,1-3H3,(H,25,29) |
| InChIKey | OOWXYMFCLXJONI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.85 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|