C19H15Cl5N4O2S — CID 17304927
2-[[5-[(2,5-dichlorophenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 17304927) has the molecular formula C19H15Cl5N4O2S and a molecular weight of 540.69 g/mol. Its IUPAC name is 2-[[5-[(2,5-dichlorophenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[5-[(2,5-dichlorophenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 17304927 |
| Molecular Formula | C19H15Cl5N4O2S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 537.94 |
| IUPAC Name | 2-[[5-[(2,5-dichlorophenoxy)methyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CCn1c(COc2cc(Cl)ccc2Cl)nnc1SCC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H15Cl5N4O2S/c1-2-28-17(8-30-16-5-10(20)3-4-11(16)21)26-27-19(28)31-9-18(29)25-15-7-13(23)12(22)6-14(15)24/h3-7H,2,8-9H2,1H3,(H,25,29) |
| InChIKey | ZBVKNPVRBKLTDZ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|