C22H21Cl3N4O2S — CID 21378364
2-[[5-[(4-ethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 21378364) has the molecular formula C22H21Cl3N4O2S and a molecular weight of 511.86 g/mol. Its IUPAC name is 2-[[5-[(4-ethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[5-[(4-ethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 21378364 |
| Molecular Formula | C22H21Cl3N4O2S |
| Molecular Weight | 511.86 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | 2-[[5-[(4-ethylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | C=CCn1c(COc2ccc(CC)cc2)nnc1SCC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C22H21Cl3N4O2S/c1-3-9-29-20(12-31-15-7-5-14(4-2)6-8-15)27-28-22(29)32-13-21(30)26-19-11-17(24)16(23)10-18(19)25/h3,5-8,10-11H,1,4,9,12-13H2,2H3,(H,26,30) |
| InChIKey | DXJSVQAXNVIYEF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.86 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|