C14H13Cl3N4OS — CID 8722885
2-[(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 8722885) has the molecular formula C14H13Cl3N4OS and a molecular weight of 391.71 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 8722885 |
| Molecular Formula | C14H13Cl3N4OS |
| Molecular Weight | 391.71 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | 2-[(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | Cc1nnc(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)n1C1CC1 |
| InChI | InChI=1S/C14H13Cl3N4OS/c1-7-19-20-14(21(7)8-2-3-8)23-6-13(22)18-12-5-10(16)9(15)4-11(12)17/h4-5,8H,2-3,6H2,1H3,(H,18,22) |
| InChIKey | YGCWVRWKZOPPAH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.71 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|