C18H17Cl3N4O2S — CID 19726404
2-[[5-(2-methylfuran-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 19726404) has the molecular formula C18H17Cl3N4O2S and a molecular weight of 459.79 g/mol. Its IUPAC name is 2-[[5-(2-methylfuran-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[5-(2-methylfuran-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 19726404 |
| Molecular Formula | C18H17Cl3N4O2S |
| Molecular Weight | 459.79 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | 2-[[5-(2-methylfuran-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CCCn1c(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)nnc1-c1ccoc1C |
| InChI | InChI=1S/C18H17Cl3N4O2S/c1-3-5-25-17(11-4-6-27-10(11)2)23-24-18(25)28-9-16(26)22-15-8-13(20)12(19)7-14(15)21/h4,6-8H,3,5,9H2,1-2H3,(H,22,26) |
| InChIKey | YJADMACRHJZTMA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.79 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|