C22H23Cl3N4OS2 — CID 19723094
2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 19723094) has the molecular formula C22H23Cl3N4OS2 and a molecular weight of 529.95 g/mol. Its IUPAC name is 2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 19723094 |
| Molecular Formula | C22H23Cl3N4OS2 |
| Molecular Weight | 529.95 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | 2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CCCn1c(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)nnc1-c1csc2c1CCC(C)C2 |
| InChI | InChI=1S/C22H23Cl3N4OS2/c1-3-6-29-21(14-10-31-19-7-12(2)4-5-13(14)19)27-28-22(29)32-11-20(30)26-18-9-16(24)15(23)8-17(18)25/h8-10,12H,3-7,11H2,1-2H3,(H,26,30) |
| InChIKey | ONKQAXOIIHUKKD-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.95 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|