C24H30N4OS2 — CID 19723047
N-(4-ethylphenyl)-2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19723047) has the molecular formula C24H30N4OS2 and a molecular weight of 454.67 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-ethylphenyl)-2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19723047 |
| Molecular Formula | C24H30N4OS2 |
| Molecular Weight | 454.67 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N-(4-ethylphenyl)-2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCCn1c(SCC(=O)Nc2ccc(CC)cc2)nnc1-c1csc2c1CCC(C)C2 |
| InChI | InChI=1S/C24H30N4OS2/c1-4-12-28-23(20-14-30-21-13-16(3)6-11-19(20)21)26-27-24(28)31-15-22(29)25-18-9-7-17(5-2)8-10-18/h7-10,14,16H,4-6,11-13,15H2,1-3H3,(H,25,29) |
| InChIKey | JRFUHTAVCHKTNK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.67 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |