C20H21ClN4OS2 — CID 19722632
N-(4-chlorophenyl)-2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19722632) has the molecular formula C20H21ClN4OS2 and a molecular weight of 433.00 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19722632 |
| Molecular Formula | C20H21ClN4OS2 |
| Molecular Weight | 433.00 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N-(4-chlorophenyl)-2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CC1CCc2c(-c3nnc(SCC(=O)Nc4ccc(Cl)cc4)n3C)csc2C1 |
| InChI | InChI=1S/C20H21ClN4OS2/c1-12-3-8-15-16(10-27-17(15)9-12)19-23-24-20(25(19)2)28-11-18(26)22-14-6-4-13(21)5-7-14/h4-7,10,12H,3,8-9,11H2,1-2H3,(H,22,26) |
| InChIKey | OTCNTFIWZOOMRH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.00 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |