C19H20ClN5OS2 — CID 17300680
N-(2-chloro-3-pyridinyl)-2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17300680) has the molecular formula C19H20ClN5OS2 and a molecular weight of 433.99 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17300680 |
| Molecular Formula | C19H20ClN5OS2 |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CC1CCc2c(-c3nnc(SCC(=O)Nc4cccnc4Cl)n3C)csc2C1 |
| InChI | InChI=1S/C19H20ClN5OS2/c1-11-5-6-12-13(9-27-15(12)8-11)18-23-24-19(25(18)2)28-10-16(26)22-14-4-3-7-21-17(14)20/h3-4,7,9,11H,5-6,8,10H2,1-2H3,(H,22,26) |
| InChIKey | RIQILTCUNWCZRU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|