C23H25F3N4OS2 — CID 19723208
2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 19723208) has the molecular formula C23H25F3N4OS2 and a molecular weight of 494.61 g/mol. Its IUPAC name is 2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 19723208 |
| Molecular Formula | C23H25F3N4OS2 |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propan-2-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC1CCc2c(-c3nnc(SCC(=O)Nc4ccccc4C(F)(F)F)n3C(C)C)csc2C1 |
| InChI | InChI=1S/C23H25F3N4OS2/c1-13(2)30-21(16-11-32-19-10-14(3)8-9-15(16)19)28-29-22(30)33-12-20(31)27-18-7-5-4-6-17(18)23(24,25)26/h4-7,11,13-14H,8-10,12H2,1-3H3,(H,27,31) |
| InChIKey | CFLANNQTIJRVSS-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |