C20H20F2N4OS2 — CID 17270133
N-(2,4-difluorophenyl)-2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17270133) has the molecular formula C20H20F2N4OS2 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17270133 |
| Molecular Formula | C20H20F2N4OS2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CC1CCc2c(-c3nnc(SCC(=O)Nc4ccc(F)cc4F)n3C)csc2C1 |
| InChI | InChI=1S/C20H20F2N4OS2/c1-11-3-5-13-14(9-28-17(13)7-11)19-24-25-20(26(19)2)29-10-18(27)23-16-6-4-12(21)8-15(16)22/h4,6,8-9,11H,3,5,7,10H2,1-2H3,(H,23,27) |
| InChIKey | AHDRJJXXVYUWOL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |