C27H28N4O3S3 — CID 19722631
ethyl 2-[[2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 19722631) has the molecular formula C27H28N4O3S3 and a molecular weight of 552.75 g/mol. Its IUPAC name is ethyl 2-[[2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19722631 |
| Molecular Formula | C27H28N4O3S3 |
| Molecular Weight | 552.75 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | ethyl 2-[[2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)CSc1nnc(-c2csc3c2CCC(C)C3)n1C |
| InChI | InChI=1S/C27H28N4O3S3/c1-4-34-26(33)23-19(17-8-6-5-7-9-17)13-36-25(23)28-22(32)15-37-27-30-29-24(31(27)3)20-14-35-21-12-16(2)10-11-18(20)21/h5-9,13-14,16H,4,10-12,15H2,1-3H3,(H,28,32) |
| InChIKey | DKDWIEFJSGWLHO-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.75 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|