C28H28N4O3S3 — CID 19722867
methyl 2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 19722867) has the molecular formula C28H28N4O3S3 and a molecular weight of 564.76 g/mol. Its IUPAC name is methyl 2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19722867 |
| Molecular Formula | C28H28N4O3S3 |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | methyl 2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2scc(-c3ccccc3)c2C(=O)OC)nnc1-c1csc2c1CCC(C)C2 |
| InChI | InChI=1S/C28H28N4O3S3/c1-4-12-32-25(21-15-36-22-13-17(2)10-11-19(21)22)30-31-28(32)38-16-23(33)29-26-24(27(34)35-3)20(14-37-26)18-8-6-5-7-9-18/h4-9,14-15,17H,1,10-13,16H2,2-3H3,(H,29,33) |
| InChIKey | QJENCLIQFXZSMX-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|