C30H32N4O3S3 — CID 19722871
methyl 4-(2,5-dimethylphenyl)-2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 19722871) has the molecular formula C30H32N4O3S3 and a molecular weight of 592.81 g/mol. Its IUPAC name is methyl 4-(2,5-dimethylphenyl)-2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(2,5-dimethylphenyl)-2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19722871 |
| Molecular Formula | C30H32N4O3S3 |
| Molecular Weight | 592.81 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | methyl 4-(2,5-dimethylphenyl)-2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | C=CCn1c(SCC(=O)Nc2scc(-c3cc(C)ccc3C)c2C(=O)OC)nnc1-c1csc2c1CCC(C)C2 |
| InChI | InChI=1S/C30H32N4O3S3/c1-6-11-34-27(23-15-38-24-13-18(3)8-10-20(23)24)32-33-30(34)40-16-25(35)31-28-26(29(36)37-5)22(14-39-28)21-12-17(2)7-9-19(21)4/h6-7,9,12,14-15,18H,1,8,10-11,13,16H2,2-5H3,(H,31,35) |
| InChIKey | FJCNRYAEMQFAPF-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.81 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|