C28H29FN4O3S3 — CID 19723020
methyl 4-(4-fluorophenyl)-2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 19723020) has the molecular formula C28H29FN4O3S3 and a molecular weight of 584.76 g/mol. Its IUPAC name is methyl 4-(4-fluorophenyl)-2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-fluorophenyl)-2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19723020 |
| Molecular Formula | C28H29FN4O3S3 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | methyl 4-(4-fluorophenyl)-2-[[2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCCn1c(SCC(=O)Nc2scc(-c3ccc(F)cc3)c2C(=O)OC)nnc1-c1csc2c1CCC(C)C2 |
| InChI | InChI=1S/C28H29FN4O3S3/c1-4-11-33-25(21-14-37-22-12-16(2)5-10-19(21)22)31-32-28(33)39-15-23(34)30-26-24(27(35)36-3)20(13-38-26)17-6-8-18(29)9-7-17/h6-9,13-14,16H,4-5,10-12,15H2,1-3H3,(H,30,34) |
| InChIKey | TZAPFJWAJWYMHV-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|