C24H28N4O2S2 — CID 19723066
N-(3-acetylphenyl)-2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19723066) has the molecular formula C24H28N4O2S2 and a molecular weight of 468.65 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19723066 |
| Molecular Formula | C24H28N4O2S2 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | N-(3-acetylphenyl)-2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-propyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCCn1c(SCC(=O)Nc2cccc(C(C)=O)c2)nnc1-c1csc2c1CCC(C)C2 |
| InChI | InChI=1S/C24H28N4O2S2/c1-4-10-28-23(20-13-31-21-11-15(2)8-9-19(20)21)26-27-24(28)32-14-22(30)25-18-7-5-6-17(12-18)16(3)29/h5-7,12-13,15H,4,8-11,14H2,1-3H3,(H,25,30) |
| InChIKey | SVXHKMAJXFZBOU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |