C23H28N4O2S2 — CID 19722766
N-(4-ethoxyphenyl)-2-[[4-ethyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19722766) has the molecular formula C23H28N4O2S2 and a molecular weight of 456.64 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[[4-ethyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[[4-ethyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19722766 |
| Molecular Formula | C23H28N4O2S2 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[[4-ethyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCOc1ccc(NC(=O)CSc2nnc(-c3csc4c3CCC(C)C4)n2CC)cc1 |
| InChI | InChI=1S/C23H28N4O2S2/c1-4-27-22(19-13-30-20-12-15(3)6-11-18(19)20)25-26-23(27)31-14-21(28)24-16-7-9-17(10-8-16)29-5-2/h7-10,13,15H,4-6,11-12,14H2,1-3H3,(H,24,28) |
| InChIKey | TZFUNRWAKSWNHS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |