C23H28N4OS2 — CID 19722749
N-(3,5-dimethylphenyl)-2-[[4-ethyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19722749) has the molecular formula C23H28N4OS2 and a molecular weight of 440.64 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[[4-ethyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[[4-ethyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19722749 |
| Molecular Formula | C23H28N4OS2 |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[[4-ethyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2cc(C)cc(C)c2)nnc1-c1csc2c1CCC(C)C2 |
| InChI | InChI=1S/C23H28N4OS2/c1-5-27-22(19-12-29-20-11-14(2)6-7-18(19)20)25-26-23(27)30-13-21(28)24-17-9-15(3)8-16(4)10-17/h8-10,12,14H,5-7,11,13H2,1-4H3,(H,24,28) |
| InChIKey | CKSAQNRZNJGUBM-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |