C22H22ClF3N4OS2 — CID 19722765
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[[4-ethyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19722765) has the molecular formula C22H22ClF3N4OS2 and a molecular weight of 515.03 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[[4-ethyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[[4-ethyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19722765 |
| Molecular Formula | C22H22ClF3N4OS2 |
| Molecular Weight | 515.03 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[[4-ethyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2cc(C(F)(F)F)ccc2Cl)nnc1-c1csc2c1CCC(C)C2 |
| InChI | InChI=1S/C22H22ClF3N4OS2/c1-3-30-20(15-10-32-18-8-12(2)4-6-14(15)18)28-29-21(30)33-11-19(31)27-17-9-13(22(24,25)26)5-7-16(17)23/h5,7,9-10,12H,3-4,6,8,11H2,1-2H3,(H,27,31) |
| InChIKey | UDHDTXBEBNVGBQ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.03 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |