C18H21N5OS3 — CID 19722785
2-[[4-ethyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 19722785) has the molecular formula C18H21N5OS3 and a molecular weight of 419.60 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[[4-ethyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 19722785 |
| Molecular Formula | C18H21N5OS3 |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2-[[4-ethyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CCn1c(SCC(=O)Nc2nccs2)nnc1-c1csc2c1CCC(C)C2 |
| InChI | InChI=1S/C18H21N5OS3/c1-3-23-16(13-9-26-14-8-11(2)4-5-12(13)14)21-22-18(23)27-10-15(24)20-17-19-6-7-25-17/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,19,20,24) |
| InChIKey | VJUMHPHMVMMHLC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |