C20H24N6OS3 — CID 19722930
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19722930) has the molecular formula C20H24N6OS3 and a molecular weight of 460.65 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19722930 |
| Molecular Formula | C20H24N6OS3 |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2nnc(CC)s2)nnc1-c1csc2c1CCC(C)C2 |
| InChI | InChI=1S/C20H24N6OS3/c1-4-8-26-18(14-10-28-15-9-12(3)6-7-13(14)15)23-25-20(26)29-11-16(27)21-19-24-22-17(5-2)30-19/h4,10,12H,1,5-9,11H2,2-3H3,(H,21,24,27) |
| InChIKey | DDXMXVHLTKSSLV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|