C18H20N6OS3 — CID 19722928
2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 19722928) has the molecular formula C18H20N6OS3 and a molecular weight of 432.60 g/mol. Its IUPAC name is 2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 19722928 |
| Molecular Formula | C18H20N6OS3 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 2-[[5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2nncs2)nnc1-c1csc2c1CCC(C)C2 |
| InChI | InChI=1S/C18H20N6OS3/c1-3-6-24-16(13-8-26-14-7-11(2)4-5-12(13)14)21-23-18(24)27-9-15(25)20-17-22-19-10-28-17/h3,8,10-11H,1,4-7,9H2,2H3,(H,20,22,25) |
| InChIKey | BNHLACLUDCHEOF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|