C17H20N6OS3 — CID 17300632
2-[[4-propyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 17300632) has the molecular formula C17H20N6OS3 and a molecular weight of 420.59 g/mol. Its IUPAC name is 2-[[4-propyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[[4-propyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 17300632 |
| Molecular Formula | C17H20N6OS3 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 2-[[4-propyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCn1c(SCC(=O)Nc2nncs2)nnc1-c1csc2c1CCCC2 |
| InChI | InChI=1S/C17H20N6OS3/c1-2-7-23-15(12-8-25-13-6-4-3-5-11(12)13)20-22-17(23)26-9-14(24)19-16-21-18-10-27-16/h8,10H,2-7,9H2,1H3,(H,19,21,24) |
| InChIKey | ZIZLQTHJQYRCRK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |