C23H23NO3S2 — CID 3478717
ethyl 2-[(6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)amino]-4-phenylthiophene-3-carboxylate (PubChem CID 3478717) has the molecular formula C23H23NO3S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is ethyl 2-[(6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3478717 |
| Molecular Formula | C23H23NO3S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | ethyl 2-[(6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)c1csc2c1CCC(C)C2 |
| InChI | InChI=1S/C23H23NO3S2/c1-3-27-23(26)20-17(15-7-5-4-6-8-15)12-29-22(20)24-21(25)18-13-28-19-11-14(2)9-10-16(18)19/h4-8,12-14H,3,9-11H2,1-2H3,(H,24,25) |
| InChIKey | KMCRAXZXQQSIBW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|