C24H25NO3S2 — CID 4573257
ethyl 2-[(6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)amino]-4-phenylthiophene-3-carboxylate (PubChem CID 4573257) has the molecular formula C24H25NO3S2 and a molecular weight of 439.60 g/mol. Its IUPAC name is ethyl 2-[(6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4573257 |
| Molecular Formula | C24H25NO3S2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | ethyl 2-[(6-ethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl)amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)c1csc2c1CCC(CC)C2 |
| InChI | InChI=1S/C24H25NO3S2/c1-3-15-10-11-17-19(14-29-20(17)12-15)22(26)25-23-21(24(27)28-4-2)18(13-30-23)16-8-6-5-7-9-16/h5-9,13-15H,3-4,10-12H2,1-2H3,(H,25,26) |
| InChIKey | VYCYTMZWFIKVRX-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|