C22H21NO3S2 — CID 18863094
ethyl 4-phenyl-2-(4,5,6,7-tetrahydro-1-benzothiophene-3-carbonylamino)thiophene-3-carboxylate (PubChem CID 18863094) has the molecular formula C22H21NO3S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is ethyl 4-phenyl-2-(4,5,6,7-tetrahydro-1-benzothiophene-3-carbonylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 4-phenyl-2-(4,5,6,7-tetrahydro-1-benzothiophene-3-carbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18863094 |
| Molecular Formula | C22H21NO3S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | ethyl 4-phenyl-2-(4,5,6,7-tetrahydro-1-benzothiophene-3-carbonylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)c1csc2c1CCCC2 |
| InChI | InChI=1S/C22H21NO3S2/c1-2-26-22(25)19-16(14-8-4-3-5-9-14)12-28-21(19)23-20(24)17-13-27-18-11-7-6-10-15(17)18/h3-5,8-9,12-13H,2,6-7,10-11H2,1H3,(H,23,24) |
| InChIKey | PMNLGSQDXYINOQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|