C22H28N2O3S — CID 1276617
ethyl 2-[[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 1276617) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is ethyl 2-[[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 1276617 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | ethyl 2-[[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)CN1C[C@H](C)C[C@@H](C)C1 |
| InChI | InChI=1S/C22H28N2O3S/c1-4-27-22(26)20-18(17-8-6-5-7-9-17)14-28-21(20)23-19(25)13-24-11-15(2)10-16(3)12-24/h5-9,14-16H,4,10-13H2,1-3H3,(H,23,25)/t15-,16-/m1/s1 |
| InChIKey | NXBHXJUJLANLDR-HZPDHXFCSA-N |
| XLogP | 4.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|