C22H26F3N3O3S — CID 112826168
ethyl 4-phenyl-2-[[2-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 112826168) has the molecular formula C22H26F3N3O3S and a molecular weight of 469.53 g/mol. Its IUPAC name is ethyl 4-phenyl-2-[[2-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-phenyl-2-[[2-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 112826168 |
| Molecular Formula | C22H26F3N3O3S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | ethyl 4-phenyl-2-[[2-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)CN1CCCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C22H26F3N3O3S/c1-2-31-21(30)19-17(16-7-4-3-5-8-16)14-32-20(19)26-18(29)13-27-9-6-10-28(12-11-27)15-22(23,24)25/h3-5,7-8,14H,2,6,9-13,15H2,1H3,(H,26,29) |
| InChIKey | UIDZWKOTQKMGRU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|