C25H26N2O3S — CID 17265640
ethyl 2-[[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 17265640) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is ethyl 2-[[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 17265640 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | ethyl 2-[[2-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)CN1CCCc2cc(C)ccc21 |
| InChI | InChI=1S/C25H26N2O3S/c1-3-30-25(29)23-20(18-8-5-4-6-9-18)16-31-24(23)26-22(28)15-27-13-7-10-19-14-17(2)11-12-21(19)27/h4-6,8-9,11-12,14,16H,3,7,10,13,15H2,1-2H3,(H,26,28) |
| InChIKey | OYINEQQFVFFNMA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|