C23H29N3O7S — CID 42913355
ethyl 4-(4-methylphenyl)-2-[[2-(4-methylpiperazin-1-yl)acetyl]amino]thiophene-3-carboxylate;oxalic acid (PubChem CID 42913355) has the molecular formula C23H29N3O7S and a molecular weight of 491.57 g/mol. Its IUPAC name is ethyl 4-(4-methylphenyl)-2-[[2-(4-methylpiperazin-1-yl)acetyl]amino]thiophene-3-carboxylate;oxalic acid.
| Compound Name | ethyl 4-(4-methylphenyl)-2-[[2-(4-methylpiperazin-1-yl)acetyl]amino]thiophene-3-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 42913355 |
| Molecular Formula | C23H29N3O7S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | ethyl 4-(4-methylphenyl)-2-[[2-(4-methylpiperazin-1-yl)acetyl]amino]thiophene-3-carboxylate;oxalic acid |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)CN1CCN(C)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H27N3O3S.C2H2O4/c1-4-27-21(26)19-17(16-7-5-15(2)6-8-16)14-28-20(19)22-18(25)13-24-11-9-23(3)10-12-24;3-1(4)2(5)6/h5-8,14H,4,9-13H2,1-3H3,(H,22,25);(H,3,4)(H,5,6) |
| InChIKey | OWNCHSCUXHOGME-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|