C18H19NO5S — CID 40573892
4-[[3-ethoxycarbonyl-4-(4-methylphenyl)thiophen-2-yl]amino]-4-oxobutanoic acid (PubChem CID 40573892) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is 4-[[3-ethoxycarbonyl-4-(4-methylphenyl)thiophen-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-ethoxycarbonyl-4-(4-methylphenyl)thiophen-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 40573892 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 4-[[3-ethoxycarbonyl-4-(4-methylphenyl)thiophen-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)CCC(=O)O |
| InChI | InChI=1S/C18H19NO5S/c1-3-24-18(23)16-13(12-6-4-11(2)5-7-12)10-25-17(16)19-14(20)8-9-15(21)22/h4-7,10H,3,8-9H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | CBMJJAAQQRBGLQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|