C22H26N4OS2 — CID 19722641
N-(2-ethylphenyl)-2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19722641) has the molecular formula C22H26N4OS2 and a molecular weight of 426.61 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19722641 |
| Molecular Formula | C22H26N4OS2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-(2-ethylphenyl)-2-[[4-methyl-5-(6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCc1ccccc1NC(=O)CSc1nnc(-c2csc3c2CCC(C)C3)n1C |
| InChI | InChI=1S/C22H26N4OS2/c1-4-15-7-5-6-8-18(15)23-20(27)13-29-22-25-24-21(26(22)3)17-12-28-19-11-14(2)9-10-16(17)19/h5-8,12,14H,4,9-11,13H2,1-3H3,(H,23,27) |
| InChIKey | SOPHVPIZJCOYAZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |