C17H15F3N4O2S — CID 7651875
2-[[4-ethyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 7651875) has the molecular formula C17H15F3N4O2S and a molecular weight of 396.39 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[4-ethyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 7651875 |
| Molecular Formula | C17H15F3N4O2S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 2-[[4-ethyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCn1c(SCC(=O)Nc2ccc(F)c(F)c2F)nnc1-c1ccoc1C |
| InChI | InChI=1S/C17H15F3N4O2S/c1-3-24-16(10-6-7-26-9(10)2)22-23-17(24)27-8-13(25)21-12-5-4-11(18)14(19)15(12)20/h4-7H,3,8H2,1-2H3,(H,21,25) |
| InChIKey | CLJUVCYBPCXUJI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|