C18H14ClF3N4OS — CID 16505747
2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 16505747) has the molecular formula C18H14ClF3N4OS and a molecular weight of 426.85 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 16505747 |
| Molecular Formula | C18H14ClF3N4OS |
| Molecular Weight | 426.85 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCn1c(SCC(=O)Nc2ccc(F)c(F)c2F)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClF3N4OS/c1-2-26-17(10-3-5-11(19)6-4-10)24-25-18(26)28-9-14(27)23-13-8-7-12(20)15(21)16(13)22/h3-8H,2,9H2,1H3,(H,23,27) |
| InChIKey | JQZRVYHSPHKRMB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.85 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|