C15H19Cl2NOS — CID 23804460
3-cyclohexylsulfanyl-N-(2,5-dichlorophenyl)propanamide (PubChem CID 23804460) has the molecular formula C15H19Cl2NOS and a molecular weight of 332.30 g/mol. Its IUPAC name is 3-cyclohexylsulfanyl-N-(2,5-dichlorophenyl)propanamide.
| Compound Name | 3-cyclohexylsulfanyl-N-(2,5-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 23804460 |
| Molecular Formula | C15H19Cl2NOS |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 3-cyclohexylsulfanyl-N-(2,5-dichlorophenyl)propanamide |
| SMILES | O=C(CCSC1CCCCC1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H19Cl2NOS/c16-11-6-7-13(17)14(10-11)18-15(19)8-9-20-12-4-2-1-3-5-12/h6-7,10,12H,1-5,8-9H2,(H,18,19) |
| InChIKey | MPGFEFLVFBUCKJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |