C11H11Cl2NO3 — CID 3516353
5-(2,5-dichloroanilino)-5-oxopentanoic acid (PubChem CID 3516353) has the molecular formula C11H11Cl2NO3 and a molecular weight of 276.12 g/mol. Its IUPAC name is 5-(2,5-dichloroanilino)-5-oxopentanoic acid.
| Compound Name | 5-(2,5-dichloroanilino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 3516353 |
| Molecular Formula | C11H11Cl2NO3 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 5-(2,5-dichloroanilino)-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H11Cl2NO3/c12-7-4-5-8(13)9(6-7)14-10(15)2-1-3-11(16)17/h4-6H,1-3H2,(H,14,15)(H,16,17) |
| InChIKey | KIPNDJFJDZZAPU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |