C9H9Cl2NO2 — CID 43558723
N-(2,5-dichlorophenyl)-3-hydroxypropanamide (PubChem CID 43558723) has the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-3-hydroxypropanamide.
| Compound Name | N-(2,5-dichlorophenyl)-3-hydroxypropanamide |
|---|---|
| PubChem CID | 43558723 |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.08 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | N-(2,5-dichlorophenyl)-3-hydroxypropanamide |
| SMILES | O=C(CCO)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H9Cl2NO2/c10-6-1-2-7(11)8(5-6)12-9(14)3-4-13/h1-2,5,13H,3-4H2,(H,12,14) |
| InChIKey | XURJFXSXRYEQJD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.08 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |