C12H17Cl2N3O — CID 55103947
3-[2-aminoethyl(methyl)amino]-N-(2,5-dichlorophenyl)propanamide (PubChem CID 55103947) has the molecular formula C12H17Cl2N3O and a molecular weight of 290.19 g/mol. Its IUPAC name is 3-[2-aminoethyl(methyl)amino]-N-(2,5-dichlorophenyl)propanamide.
| Compound Name | 3-[2-aminoethyl(methyl)amino]-N-(2,5-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 55103947 |
| Molecular Formula | C12H17Cl2N3O |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 3-[2-aminoethyl(methyl)amino]-N-(2,5-dichlorophenyl)propanamide |
| SMILES | CN(CCN)CCC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H17Cl2N3O/c1-17(7-5-15)6-4-12(18)16-11-8-9(13)2-3-10(11)14/h2-3,8H,4-7,15H2,1H3,(H,16,18) |
| InChIKey | CPTZJEZLDZASGH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |