C9H9Cl2NOS — CID 47097975
N-(2,5-dichlorophenyl)-2-methylsulfanylacetamide (PubChem CID 47097975) has the molecular formula C9H9Cl2NOS and a molecular weight of 250.15 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-methylsulfanylacetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 47097975 |
| Molecular Formula | C9H9Cl2NOS |
| Molecular Weight | 250.15 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H9Cl2NOS/c1-14-5-9(13)12-8-4-6(10)2-3-7(8)11/h2-4H,5H2,1H3,(H,12,13) |
| InChIKey | SDMRVIDCQYOKQI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.15 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |