C13H14Cl2N2O4 — CID 43447201
6-[(2,5-dichlorophenyl)carbamoylamino]-6-oxohexanoic acid (PubChem CID 43447201) has the molecular formula C13H14Cl2N2O4 and a molecular weight of 333.17 g/mol. Its IUPAC name is 6-[(2,5-dichlorophenyl)carbamoylamino]-6-oxohexanoic acid.
| Compound Name | 6-[(2,5-dichlorophenyl)carbamoylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 43447201 |
| Molecular Formula | C13H14Cl2N2O4 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 6-[(2,5-dichlorophenyl)carbamoylamino]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)NC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H14Cl2N2O4/c14-8-5-6-9(15)10(7-8)16-13(21)17-11(18)3-1-2-4-12(19)20/h5-7H,1-4H2,(H,19,20)(H2,16,17,18,21) |
| InChIKey | BAVFNPGSMRRUBJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|