C12H12Cl2N2O4 — CID 28931983
5-[(2,3-dichlorophenyl)carbamoylamino]-5-oxopentanoic acid (PubChem CID 28931983) has the molecular formula C12H12Cl2N2O4 and a molecular weight of 319.14 g/mol. Its IUPAC name is 5-[(2,3-dichlorophenyl)carbamoylamino]-5-oxopentanoic acid.
| Compound Name | 5-[(2,3-dichlorophenyl)carbamoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 28931983 |
| Molecular Formula | C12H12Cl2N2O4 |
| Molecular Weight | 319.14 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 5-[(2,3-dichlorophenyl)carbamoylamino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)NC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H12Cl2N2O4/c13-7-3-1-4-8(11(7)14)15-12(20)16-9(17)5-2-6-10(18)19/h1,3-4H,2,5-6H2,(H,18,19)(H2,15,16,17,20) |
| InChIKey | SVZMBASZPSILKN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.14 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |