C11H11ClN2O4 — CID 28746375
4-[(2-chlorophenyl)carbamoylamino]-4-oxobutanoic acid (PubChem CID 28746375) has the molecular formula C11H11ClN2O4 and a molecular weight of 270.67 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)carbamoylamino]-4-oxobutanoic acid.
| Compound Name | 4-[(2-chlorophenyl)carbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 28746375 |
| Molecular Formula | C11H11ClN2O4 |
| Molecular Weight | 270.67 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 4-[(2-chlorophenyl)carbamoylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C11H11ClN2O4/c12-7-3-1-2-4-8(7)13-11(18)14-9(15)5-6-10(16)17/h1-4H,5-6H2,(H,16,17)(H2,13,14,15,18) |
| InChIKey | SKBONJPVPDEZAW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.67 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |