C10H12ClN3O2 — CID 12876419
1-(2-chlorophenyl)-3-(ethylcarbamoyl)urea (PubChem CID 12876419) has the molecular formula C10H12ClN3O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-(ethylcarbamoyl)urea.
| Compound Name | 1-(2-chlorophenyl)-3-(ethylcarbamoyl)urea |
|---|---|
| PubChem CID | 12876419 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 1-(2-chlorophenyl)-3-(ethylcarbamoyl)urea |
| SMILES | CCNC(=O)NC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C10H12ClN3O2/c1-2-12-9(15)14-10(16)13-8-6-4-3-5-7(8)11/h3-6H,2H2,1H3,(H3,12,13,14,15,16) |
| InChIKey | ZYTFFHWXLAACPX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |