C17H19ClN2O — CID 4994979
1-(2-chlorophenyl)-3-(2,6-diethylphenyl)urea (PubChem CID 4994979) has the molecular formula C17H19ClN2O and a molecular weight of 302.80 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-(2,6-diethylphenyl)urea.
| Compound Name | 1-(2-chlorophenyl)-3-(2,6-diethylphenyl)urea |
|---|---|
| PubChem CID | 4994979 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-(2-chlorophenyl)-3-(2,6-diethylphenyl)urea |
| SMILES | CCc1cccc(CC)c1NC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H19ClN2O/c1-3-12-8-7-9-13(4-2)16(12)20-17(21)19-15-11-6-5-10-14(15)18/h5-11H,3-4H2,1-2H3,(H2,19,20,21) |
| InChIKey | XPURMUXHWCZTIR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |