C13H9Cl3N2O — CID 5174981
1-(2-chlorophenyl)-3-(2,3-dichlorophenyl)urea (PubChem CID 5174981) has the molecular formula C13H9Cl3N2O and a molecular weight of 315.59 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-(2,3-dichlorophenyl)urea.
| Compound Name | 1-(2-chlorophenyl)-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 5174981 |
| Molecular Formula | C13H9Cl3N2O |
| Molecular Weight | 315.59 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 1-(2-chlorophenyl)-3-(2,3-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccccc1Cl)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H9Cl3N2O/c14-8-4-1-2-6-10(8)17-13(19)18-11-7-3-5-9(15)12(11)16/h1-7H,(H2,17,18,19) |
| InChIKey | ZGJCMSWOBVSNAW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |